C27H40INO7 — CID 66845237
acetic acid;2-(2-hydroxyethyl)-4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenol (PubChem CID 66845237) has the molecular formula C27H40INO7 and a molecular weight of 617.52 g/mol. Its IUPAC name is acetic acid;2-(2-hydroxyethyl)-4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenol.
| Compound Name | acetic acid;2-(2-hydroxyethyl)-4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenol |
|---|---|
| PubChem CID | 66845237 |
| Molecular Formula | C27H40INO7 |
| Molecular Weight | 617.52 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | acetic acid;2-(2-hydroxyethyl)-4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenol |
| SMILES | CC(=O)O.OCCc1cc([C@@H](O)CNCCCCCCOCCOCc2cccc(I)c2)ccc1O |
| InChI | InChI=1S/C25H36INO5.C2H4O2/c26-23-7-5-6-20(16-23)19-32-15-14-31-13-4-2-1-3-11-27-18-25(30)21-8-9-24(29)22(17-21)10-12-28;1-2(3)4/h5-9,16-17,25,27-30H,1-4,10-15,18-19H2;1H3,(H,3,4)/t25-;/m0./s1 |
| InChIKey | FSCIWEYALZHAKM-UQIIZPHYSA-N |
| XLogP | 4.04 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|