C27H38INO6 — CID 77195720
[2-(2-hydroxyethyl)-4-[1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenyl] acetate (PubChem CID 77195720) has the molecular formula C27H38INO6 and a molecular weight of 599.51 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)-4-[1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenyl] acetate.
| Compound Name | [2-(2-hydroxyethyl)-4-[1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 77195720 |
| Molecular Formula | C27H38INO6 |
| Molecular Weight | 599.51 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | [2-(2-hydroxyethyl)-4-[1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(O)CNCCCCCCOCCOCc2cccc(I)c2)cc1CCO |
| InChI | InChI=1S/C27H38INO6/c1-21(31)35-27-10-9-23(18-24(27)11-13-30)26(32)19-29-12-4-2-3-5-14-33-15-16-34-20-22-7-6-8-25(28)17-22/h6-10,17-18,26,29-30,32H,2-5,11-16,19-20H2,1H3 |
| InChIKey | KRLVVVNRVUCAJZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|