C34H43N5O5 — CID 90926126
[2-(hydroxymethyl)-4-[1-hydroxy-2-[6-[4-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethyl]phenyl] acetate (PubChem CID 90926126) has the molecular formula C34H43N5O5 and a molecular weight of 601.75 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-[1-hydroxy-2-[6-[4-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethyl]phenyl] acetate.
| Compound Name | [2-(hydroxymethyl)-4-[1-hydroxy-2-[6-[4-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 90926126 |
| Molecular Formula | C34H43N5O5 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.33 |
| IUPAC Name | [2-(hydroxymethyl)-4-[1-hydroxy-2-[6-[4-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(O)CNCCCCCCOCCCCc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)cc1CO |
| InChI | InChI=1S/C34H43N5O5/c1-25(41)44-33-18-17-28(22-29(33)24-40)32(42)23-35-19-7-2-3-8-20-43-21-9-6-10-26-13-15-27(16-14-26)30-11-4-5-12-31(30)34-36-38-39-37-34/h4-5,11-18,22,32,35,40,42H,2-3,6-10,19-21,23-24H2,1H3,(H,36,37,38,39) |
| InChIKey | PGEUMGZWMQYYSA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|