C30H37NO6 — CID 69439199
[2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(3-phenylmethoxypropoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate (PubChem CID 69439199) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(3-phenylmethoxypropoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate.
| Compound Name | [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(3-phenylmethoxypropoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 69439199 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(3-phenylmethoxypropoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](O)CNCCc2cccc(COCCCOCc3ccccc3)c2)cc1CO |
| InChI | InChI=1S/C30H37NO6/c1-23(33)37-30-12-11-27(18-28(30)20-32)29(34)19-31-14-13-24-9-5-10-26(17-24)22-36-16-6-15-35-21-25-7-3-2-4-8-25/h2-5,7-12,17-18,29,31-32,34H,6,13-16,19-22H2,1H3/t29-/m0/s1 |
| InChIKey | WSKDGIRWNPTDAQ-LJAQVGFWSA-N |
| XLogP | 4.09 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|