C28H32FNO6 — CID 69384236
[4-[(1R)-2-[2-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] acetate (PubChem CID 69384236) has the molecular formula C28H32FNO6 and a molecular weight of 497.56 g/mol. Its IUPAC name is [4-[(1R)-2-[2-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] acetate.
| Compound Name | [4-[(1R)-2-[2-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] acetate |
|---|---|
| PubChem CID | 69384236 |
| Molecular Formula | C28H32FNO6 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | [4-[(1R)-2-[2-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]ethylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](O)CNCCc2ccc(OCCOCc3cccc(F)c3)cc2)cc1CO |
| InChI | InChI=1S/C28H32FNO6/c1-20(32)36-28-10-7-23(16-24(28)18-31)27(33)17-30-12-11-21-5-8-26(9-6-21)35-14-13-34-19-22-3-2-4-25(29)15-22/h2-10,15-16,27,30-31,33H,11-14,17-19H2,1H3/t27-/m0/s1 |
| InChIKey | HFRWQZGBEKRINE-MHZLTWQESA-N |
| XLogP | 3.70 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|