C28H33NO5 — CID 69435469
[2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(2-phenylethoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate (PubChem CID 69435469) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(2-phenylethoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate.
| Compound Name | [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(2-phenylethoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 69435469 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[2-[3-(2-phenylethoxymethyl)phenyl]ethylamino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](O)CNCCc2cccc(COCCc3ccccc3)c2)cc1CO |
| InChI | InChI=1S/C28H33NO5/c1-21(31)34-28-11-10-25(17-26(28)19-30)27(32)18-29-14-12-23-8-5-9-24(16-23)20-33-15-13-22-6-3-2-4-7-22/h2-11,16-17,27,29-30,32H,12-15,18-20H2,1H3/t27-/m0/s1 |
| InChIKey | FMCFFIQKCFIBMH-MHZLTWQESA-N |
| XLogP | 3.73 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|