C27H39NO5 — CID 142887381
[2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[6-(2-methyl-2-phenylpropoxy)hexylamino]ethyl]phenyl] acetate (PubChem CID 142887381) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[6-(2-methyl-2-phenylpropoxy)hexylamino]ethyl]phenyl] acetate.
| Compound Name | [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[6-(2-methyl-2-phenylpropoxy)hexylamino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 142887381 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | [2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[6-(2-methyl-2-phenylpropoxy)hexylamino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](O)CNCCCCCCOCC(C)(C)c2ccccc2)cc1CO |
| InChI | InChI=1S/C27H39NO5/c1-21(30)33-26-14-13-22(17-23(26)19-29)25(31)18-28-15-9-4-5-10-16-32-20-27(2,3)24-11-7-6-8-12-24/h6-8,11-14,17,25,28-29,31H,4-5,9-10,15-16,18-20H2,1-3H3/t25-/m0/s1 |
| InChIKey | QIPHJGPZONNKFH-VWLOTQADSA-N |
| XLogP | 4.28 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|