C36H50N2O8S — CID 87730981
[[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonyl-(2-phenylpropan-2-yl)amino] acetate (PubChem CID 87730981) has the molecular formula C36H50N2O8S and a molecular weight of 670.87 g/mol. Its IUPAC name is [[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonyl-(2-phenylpropan-2-yl)amino] acetate.
| Compound Name | [[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonyl-(2-phenylpropan-2-yl)amino] acetate |
|---|---|
| PubChem CID | 87730981 |
| Molecular Formula | C36H50N2O8S |
| Molecular Weight | 670.87 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | [[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonyl-(2-phenylpropan-2-yl)amino] acetate |
| SMILES | CC(=O)ON(C(C)(C)c1ccccc1)S(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C36H50N2O8S/c1-28(40)46-38(36(2,3)32-16-7-6-8-17-32)47(43,44)33-18-13-15-29(24-33)14-9-12-23-45-22-11-5-4-10-21-37-26-35(42)30-19-20-34(41)31(25-30)27-39/h6-8,13,15-20,24-25,35,37,39,41-42H,4-5,9-12,14,21-23,26-27H2,1-3H3/t35-/m1/s1 |
| InChIKey | KFPCTKKHURXICM-PGUFJCEWSA-N |
| XLogP | 5.51 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.87 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|