C31H47NO6S — CID 10482961
4-[(1R)-2-[6-[5-(3-cyclopentylsulfonylphenyl)pentoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol (PubChem CID 10482961) has the molecular formula C31H47NO6S and a molecular weight of 561.79 g/mol. Its IUPAC name is 4-[(1R)-2-[6-[5-(3-cyclopentylsulfonylphenyl)pentoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[(1R)-2-[6-[5-(3-cyclopentylsulfonylphenyl)pentoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 10482961 |
| Molecular Formula | C31H47NO6S |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 4-[(1R)-2-[6-[5-(3-cyclopentylsulfonylphenyl)pentoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| SMILES | O=S(=O)(c1cccc(CCCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1)C1CCCC1 |
| InChI | InChI=1S/C31H47NO6S/c33-24-27-22-26(16-17-30(27)34)31(35)23-32-18-7-1-2-8-19-38-20-9-3-4-11-25-12-10-15-29(21-25)39(36,37)28-13-5-6-14-28/h10,12,15-17,21-22,28,31-35H,1-9,11,13-14,18-20,23-24H2/t31-/m0/s1 |
| InChIKey | DXDPRGIAAPVRTR-HKBQPEDESA-N |
| XLogP | 5.21 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|