C34H44N2O8S — CID 69220058
[[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonylamino] (E)-3-phenylprop-2-enoate (PubChem CID 69220058) has the molecular formula C34H44N2O8S and a molecular weight of 640.80 g/mol. Its IUPAC name is [[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonylamino] (E)-3-phenylprop-2-enoate.
| Compound Name | [[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonylamino] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 69220058 |
| Molecular Formula | C34H44N2O8S |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | [[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]sulfonylamino] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)ONS(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C34H44N2O8S/c37-26-30-24-29(17-18-32(30)38)33(39)25-35-20-7-1-2-8-21-43-22-9-6-13-28-14-10-15-31(23-28)45(41,42)36-44-34(40)19-16-27-11-4-3-5-12-27/h3-5,10-12,14-19,23-24,33,35-39H,1-2,6-9,13,20-22,25-26H2/b19-16+/t33-/m1/s1 |
| InChIKey | RHPFATMPYWLOAW-UYOPKICRSA-N |
| XLogP | 4.56 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|