C35H46N2O7S — CID 69220740
[2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-(4-methylphenyl)prop-2-enoate (PubChem CID 69220740) has the molecular formula C35H46N2O7S and a molecular weight of 638.83 g/mol. Its IUPAC name is [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 69220740 |
| Molecular Formula | C35H46N2O7S |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)OCc2cc([C@@H](O)CNCCCCCCOCCCCc3cccc(S(N)(=O)=O)c3)ccc2O)cc1 |
| InChI | InChI=1S/C35H46N2O7S/c1-27-12-14-28(15-13-27)16-19-35(40)44-26-31-24-30(17-18-33(31)38)34(39)25-37-20-5-2-3-6-21-43-22-7-4-9-29-10-8-11-32(23-29)45(36,41)42/h8,10-19,23-24,34,37-39H,2-7,9,20-22,25-26H2,1H3,(H2,36,41,42)/t34-/m0/s1 |
| InChIKey | RGBVWBUNJNTSDL-UMSFTDKQSA-N |
| XLogP | 5.33 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|