C35H48N2O9S — CID 69218783
3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]benzenesulfonamide;(E)-3-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 69218783) has the molecular formula C35H48N2O9S and a molecular weight of 672.84 g/mol. Its IUPAC name is 3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]benzenesulfonamide;(E)-3-(4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]benzenesulfonamide;(E)-3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69218783 |
| Molecular Formula | C35H48N2O9S |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | 3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]benzenesulfonamide;(E)-3-(4-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1.NS(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C25H38N2O6S.C10H10O3/c26-34(31,32)23-10-7-9-20(16-23)8-3-6-15-33-14-5-2-1-4-13-27-18-25(30)21-11-12-24(29)22(17-21)19-28;1-13-9-5-2-8(3-6-9)4-7-10(11)12/h7,9-12,16-17,25,27-30H,1-6,8,13-15,18-19H2,(H2,26,31,32);2-7H,1H3,(H,11,12)/b;7-4+/t25-;/m0./s1 |
| InChIKey | PXGKIMUWOAAEJU-ZLQZWZBMSA-N |
| XLogP | 4.55 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|