C34H44BrNO6 — CID 10211565
(E)-3-(4-bromophenyl)prop-2-enoic acid;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol (PubChem CID 10211565) has the molecular formula C34H44BrNO6 and a molecular weight of 642.63 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)prop-2-enoic acid;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol.
| Compound Name | (E)-3-(4-bromophenyl)prop-2-enoic acid;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol |
|---|---|
| PubChem CID | 10211565 |
| Molecular Formula | C34H44BrNO6 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | (E)-3-(4-bromophenyl)prop-2-enoic acid;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol |
| SMILES | O=C(O)/C=C/c1ccc(Br)cc1.OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O |
| InChI | InChI=1S/C25H37NO4.C9H7BrO2/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21;10-8-4-1-7(2-5-8)3-6-9(11)12/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2;1-6H,(H,11,12)/b;6-3+ |
| InChIKey | HYAQTHDRVRHWLX-GNRCENTLSA-N |
| XLogP | 6.65 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|