C32H43N3O5 — CID 10152918
1-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea (PubChem CID 10152918) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is 1-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 10152918 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 1-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C32H43N3O5/c36-24-27-22-26(16-17-30(27)37)31(38)23-33-18-7-1-2-8-19-40-20-9-6-11-25-12-10-15-29(21-25)35-32(39)34-28-13-4-3-5-14-28/h3-5,10,12-17,21-22,31,33,36-38H,1-2,6-9,11,18-20,23-24H2,(H2,34,35,39)/t31-/m0/s1 |
| InChIKey | VFFNOKINDQJESJ-HKBQPEDESA-N |
| XLogP | 5.75 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|