C34H44N2O7S — CID 69220055
[2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-phenylprop-2-enoate (PubChem CID 69220055) has the molecular formula C34H44N2O7S and a molecular weight of 624.80 g/mol. Its IUPAC name is [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-phenylprop-2-enoate.
| Compound Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 69220055 |
| Molecular Formula | C34H44N2O7S |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl 3-phenylprop-2-enoate |
| SMILES | NS(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(COC(=O)C=Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C34H44N2O7S/c35-44(40,41)31-15-10-14-28(23-31)13-6-9-22-42-21-8-2-1-7-20-36-25-33(38)29-17-18-32(37)30(24-29)26-43-34(39)19-16-27-11-4-3-5-12-27/h3-5,10-12,14-19,23-24,33,36-38H,1-2,6-9,13,20-22,25-26H2,(H2,35,40,41)/t33-/m0/s1 |
| InChIKey | WZRZHPNWMYEVMO-XIFFEERXSA-N |
| XLogP | 5.02 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|