C30H45N3O8S — CID 69199143
[5-[(1R)-2-[6-[4-[3-(ethylcarbamoylsulfamoyl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate (PubChem CID 69199143) has the molecular formula C30H45N3O8S and a molecular weight of 607.77 g/mol. Its IUPAC name is [5-[(1R)-2-[6-[4-[3-(ethylcarbamoylsulfamoyl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate.
| Compound Name | [5-[(1R)-2-[6-[4-[3-(ethylcarbamoylsulfamoyl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 69199143 |
| Molecular Formula | C30H45N3O8S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | [5-[(1R)-2-[6-[4-[3-(ethylcarbamoylsulfamoyl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate |
| SMILES | CCNC(=O)NS(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(COC(C)=O)c2)c1 |
| InChI | InChI=1S/C30H45N3O8S/c1-3-32-30(37)33-42(38,39)27-13-10-12-24(19-27)11-6-9-18-40-17-8-5-4-7-16-31-21-29(36)25-14-15-28(35)26(20-25)22-41-23(2)34/h10,12-15,19-20,29,31,35-36H,3-9,11,16-18,21-22H2,1-2H3,(H2,32,33,37)/t29-/m0/s1 |
| InChIKey | KDVAJEYDPVTJJS-LJAQVGFWSA-N |
| XLogP | 3.69 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|