C28H42N2O7S — CID 69199327
[2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-methyl-5-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl acetate (PubChem CID 69199327) has the molecular formula C28H42N2O7S and a molecular weight of 550.72 g/mol. Its IUPAC name is [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-methyl-5-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl acetate.
| Compound Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-methyl-5-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 69199327 |
| Molecular Formula | C28H42N2O7S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[6-[4-(3-methyl-5-sulfamoylphenyl)butoxy]hexylamino]ethyl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc([C@@H](O)CNCCCCCCOCCCCc2cc(C)cc(S(N)(=O)=O)c2)ccc1O |
| InChI | InChI=1S/C28H42N2O7S/c1-21-15-23(17-26(16-21)38(29,34)35)9-5-8-14-36-13-7-4-3-6-12-30-19-28(33)24-10-11-27(32)25(18-24)20-37-22(2)31/h10-11,15-18,28,30,32-33H,3-9,12-14,19-20H2,1-2H3,(H2,29,34,35)/t28-/m0/s1 |
| InChIKey | BSVYCXONSFUELZ-NDEPHWFRSA-N |
| XLogP | 3.63 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|