C24H35FN2O5S — CID 10050942
3-[3-[7-[[(2R)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]benzenesulfonamide (PubChem CID 10050942) has the molecular formula C24H35FN2O5S and a molecular weight of 482.62 g/mol. Its IUPAC name is 3-[3-[7-[[(2R)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]benzenesulfonamide.
| Compound Name | 3-[3-[7-[[(2R)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10050942 |
| Molecular Formula | C24H35FN2O5S |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[3-[7-[[(2R)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CCCOCCCCCCCNC[C@H](O)c2ccc(O)c(F)c2)c1 |
| InChI | InChI=1S/C24H35FN2O5S/c25-22-17-20(11-12-23(22)28)24(29)18-27-13-4-2-1-3-5-14-32-15-7-9-19-8-6-10-21(16-19)33(26,30)31/h6,8,10-12,16-17,24,27-29H,1-5,7,9,13-15,18H2,(H2,26,30,31)/t24-/m0/s1 |
| InChIKey | RUULXHAJSUTETN-DEOSSOPVSA-N |
| XLogP | 3.40 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|