C25H35FN2O7S — CID 69322443
[[3-[3-[7-[[(2S)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]phenyl]sulfonylamino] formate (PubChem CID 69322443) has the molecular formula C25H35FN2O7S and a molecular weight of 526.63 g/mol. Its IUPAC name is [[3-[3-[7-[[(2S)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]phenyl]sulfonylamino] formate.
| Compound Name | [[3-[3-[7-[[(2S)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]phenyl]sulfonylamino] formate |
|---|---|
| PubChem CID | 69322443 |
| Molecular Formula | C25H35FN2O7S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | [[3-[3-[7-[[(2S)-2-(3-fluoro-4-hydroxyphenyl)-2-hydroxyethyl]amino]heptoxy]propyl]phenyl]sulfonylamino] formate |
| SMILES | O=CONS(=O)(=O)c1cccc(CCCOCCCCCCCNC[C@@H](O)c2ccc(O)c(F)c2)c1 |
| InChI | InChI=1S/C25H35FN2O7S/c26-23-17-21(11-12-24(23)30)25(31)18-27-13-4-2-1-3-5-14-34-15-7-9-20-8-6-10-22(16-20)36(32,33)28-35-19-29/h6,8,10-12,16-17,19,25,27-28,30-31H,1-5,7,9,13-15,18H2/t25-/m1/s1 |
| InChIKey | KGKUELLVTARFAG-RUZDIDTESA-N |
| XLogP | 3.12 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|