C25H36AsN2O6S — CID 87926552
CID 87926552 (PubChem CID 87926552) has the molecular formula C25H36AsN2O6S and a molecular weight of 567.56 g/mol.
| Compound Name | CID 87926552 |
|---|---|
| PubChem CID | 87926552 |
| Molecular Formula | C25H36AsN2O6S |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@@H](O)c2ccc(O)c([As]C=O)c2)c1 |
| InChI | InChI=1S/C25H36AsN2O6S/c27-35(32,33)22-10-7-9-20(16-22)8-3-6-15-34-14-5-2-1-4-13-28-18-25(31)21-11-12-24(30)23(17-21)26-19-29/h7,9-12,16-17,19,25,28,30-31H,1-6,8,13-15,18H2,(H2,27,32,33)/t25-/m1/s1 |
| InChIKey | ZKRWTXFULUBSET-RUZDIDTESA-N |
| XLogP | 1.78 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|