C24H32Cl2FNO6 — CID 68862914
4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-fluorophenol;formic acid (PubChem CID 68862914) has the molecular formula C24H32Cl2FNO6 and a molecular weight of 520.43 g/mol. Its IUPAC name is 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-fluorophenol;formic acid.
| Compound Name | 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-fluorophenol;formic acid |
|---|---|
| PubChem CID | 68862914 |
| Molecular Formula | C24H32Cl2FNO6 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-fluorophenol;formic acid |
| SMILES | O=CO.Oc1ccc([C@@H](O)CNCCCCCCOCCOCc2c(Cl)cccc2Cl)cc1F |
| InChI | InChI=1S/C23H30Cl2FNO4.CH2O2/c24-19-6-5-7-20(25)18(19)16-31-13-12-30-11-4-2-1-3-10-27-15-23(29)17-8-9-22(28)21(26)14-17;2-1-3/h5-9,14,23,27-29H,1-4,10-13,15-16H2;1H,(H,2,3)/t23-;/m0./s1 |
| InChIKey | JHHJJGQAJRRMNU-BQAIUKQQSA-N |
| XLogP | 4.96 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|