C25H34Cl2N2O8S — CID 91425449
[5-[2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-hydroxy-N-methylsulfonylanilino] formate (PubChem CID 91425449) has the molecular formula C25H34Cl2N2O8S and a molecular weight of 593.53 g/mol. Its IUPAC name is [5-[2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-hydroxy-N-methylsulfonylanilino] formate.
| Compound Name | [5-[2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-hydroxy-N-methylsulfonylanilino] formate |
|---|---|
| PubChem CID | 91425449 |
| Molecular Formula | C25H34Cl2N2O8S |
| Molecular Weight | 593.53 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | [5-[2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-hydroxy-N-methylsulfonylanilino] formate |
| SMILES | CS(=O)(=O)N(OC=O)c1cc(C(O)CNCCCCCCOCCOCc2c(Cl)cccc2Cl)ccc1O |
| InChI | InChI=1S/C25H34Cl2N2O8S/c1-38(33,34)29(37-18-30)23-15-19(9-10-24(23)31)25(32)16-28-11-4-2-3-5-12-35-13-14-36-17-20-21(26)7-6-8-22(20)27/h6-10,15,18,25,28,31-32H,2-5,11-14,16-17H2,1H3 |
| InChIKey | LOJBNGJGTYMHOG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|