C26H37Cl2NO5 — CID 144587826
(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-[4-ethoxy-3-(hydroxymethyl)phenyl]ethanol (PubChem CID 144587826) has the molecular formula C26H37Cl2NO5 and a molecular weight of 514.49 g/mol. Its IUPAC name is (1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-[4-ethoxy-3-(hydroxymethyl)phenyl]ethanol.
| Compound Name | (1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-[4-ethoxy-3-(hydroxymethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 144587826 |
| Molecular Formula | C26H37Cl2NO5 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-[4-ethoxy-3-(hydroxymethyl)phenyl]ethanol |
| SMILES | CCOc1ccc([C@@H](O)CNCCCCCCOCCOCc2c(Cl)cccc2Cl)cc1CO |
| InChI | InChI=1S/C26H37Cl2NO5/c1-2-34-26-11-10-20(16-21(26)18-30)25(31)17-29-12-5-3-4-6-13-32-14-15-33-19-22-23(27)8-7-9-24(22)28/h7-11,16,25,29-31H,2-6,12-15,17-19H2,1H3/t25-/m0/s1 |
| InChIKey | POOKGVSBVMCKMM-VWLOTQADSA-N |
| XLogP | 5.30 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|