C16H27NO4 — CID 20739121
4-[1-hydroxy-2-(6-methoxyhexylamino)ethyl]-2-(hydroxymethyl)phenol (PubChem CID 20739121) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(6-methoxyhexylamino)ethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[1-hydroxy-2-(6-methoxyhexylamino)ethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 20739121 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-[1-hydroxy-2-(6-methoxyhexylamino)ethyl]-2-(hydroxymethyl)phenol |
| SMILES | COCCCCCCNCC(O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C16H27NO4/c1-21-9-5-3-2-4-8-17-11-16(20)13-6-7-15(19)14(10-13)12-18/h6-7,10,16-20H,2-5,8-9,11-12H2,1H3 |
| InChIKey | IMAPXZSXLYOOAQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|