C25H33NO9 — CID 23352677
6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl 2-phenylacetate;oxalic acid (PubChem CID 23352677) has the molecular formula C25H33NO9 and a molecular weight of 491.54 g/mol. Its IUPAC name is 6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl 2-phenylacetate;oxalic acid.
| Compound Name | 6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl 2-phenylacetate;oxalic acid |
|---|---|
| PubChem CID | 23352677 |
| Molecular Formula | C25H33NO9 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexyl 2-phenylacetate;oxalic acid |
| SMILES | O=C(Cc1ccccc1)OCCCCCCNCC(O)c1ccc(O)c(CO)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H31NO5.C2H2O4/c25-17-20-15-19(10-11-21(20)26)22(27)16-24-12-6-1-2-7-13-29-23(28)14-18-8-4-3-5-9-18;3-1(4)2(5)6/h3-5,8-11,15,22,24-27H,1-2,6-7,12-14,16-17H2;(H,3,4)(H,5,6) |
| InChIKey | RNPYNRRYLASRNY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|