C22H29NO6 — CID 23352578
5-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentyl 2-(3-hydroxyphenyl)acetate (PubChem CID 23352578) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentyl 2-(3-hydroxyphenyl)acetate.
| Compound Name | 5-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentyl 2-(3-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 23352578 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 5-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentyl 2-(3-hydroxyphenyl)acetate |
| SMILES | O=C(Cc1cccc(O)c1)OCCCCCNCC(O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C22H29NO6/c24-15-18-13-17(7-8-20(18)26)21(27)14-23-9-2-1-3-10-29-22(28)12-16-5-4-6-19(25)11-16/h4-8,11,13,21,23-27H,1-3,9-10,12,14-15H2 |
| InChIKey | KYXLGGSCINRFAM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|