C26H40N2O7S — CID 69196747
5-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-2-methoxybenzenesulfonamide (PubChem CID 69196747) has the molecular formula C26H40N2O7S and a molecular weight of 524.68 g/mol. Its IUPAC name is 5-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 69196747 |
| Molecular Formula | C26H40N2O7S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 5-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C26H40N2O7S/c1-34-25-12-9-20(16-26(25)36(27,32)33)8-4-7-15-35-14-6-3-2-5-13-28-18-24(31)21-10-11-23(30)22(17-21)19-29/h9-12,16-17,24,28-31H,2-8,13-15,18-19H2,1H3,(H2,27,32,33)/t24-/m0/s1 |
| InChIKey | OLKHIDJLHVOGII-DEOSSOPVSA-N |
| XLogP | 2.76 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|