C23H36N2O6S2 — CID 11283442
4-[4-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]thiophene-2-sulfonamide (PubChem CID 11283442) has the molecular formula C23H36N2O6S2 and a molecular weight of 500.68 g/mol. Its IUPAC name is 4-[4-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]thiophene-2-sulfonamide.
| Compound Name | 4-[4-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11283442 |
| Molecular Formula | C23H36N2O6S2 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[4-[6-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(CCCCOCCCCCCNCC(O)c2ccc(O)c(CO)c2)cs1 |
| InChI | InChI=1S/C23H36N2O6S2/c24-33(29,30)23-13-18(17-32-23)7-3-6-12-31-11-5-2-1-4-10-25-15-22(28)19-8-9-21(27)20(14-19)16-26/h8-9,13-14,17,22,25-28H,1-7,10-12,15-16H2,(H2,24,29,30) |
| InChIKey | SRGCWSRFRLZBDN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|