C30H48N2O6S — CID 69200109
3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-5-pentylbenzenesulfonamide (PubChem CID 69200109) has the molecular formula C30H48N2O6S and a molecular weight of 564.79 g/mol. Its IUPAC name is 3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-5-pentylbenzenesulfonamide.
| Compound Name | 3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-5-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 69200109 |
| Molecular Formula | C30H48N2O6S |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]-5-pentylbenzenesulfonamide |
| SMILES | CCCCCc1cc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C30H48N2O6S/c1-2-3-6-11-24-18-25(20-28(19-24)39(31,36)37)12-7-10-17-38-16-9-5-4-8-15-32-22-30(35)26-13-14-29(34)27(21-26)23-33/h13-14,18-21,30,32-35H,2-12,15-17,22-23H2,1H3,(H2,31,36,37)/t30-/m0/s1 |
| InChIKey | NGRVWDVBHQOPRW-PMERELPUSA-N |
| XLogP | 4.49 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|