C20H25NO5 — CID 67933215
methyl 4-[3-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]propyl]benzoate (PubChem CID 67933215) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl 4-[3-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]propyl]benzoate.
| Compound Name | methyl 4-[3-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 67933215 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl 4-[3-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCNC[C@H](O)c2ccc(O)c(CO)c2)cc1 |
| InChI | InChI=1S/C20H25NO5/c1-26-20(25)15-6-4-14(5-7-15)3-2-10-21-12-19(24)16-8-9-18(23)17(11-16)13-22/h4-9,11,19,21-24H,2-3,10,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | HLQMMMAULGVCNP-IBGZPJMESA-N |
| XLogP | 1.93 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|