C28H41Cl2NO5 — CID 90076564
4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-ethoxyethyl]-2-(ethoxymethyl)phenol (PubChem CID 90076564) has the molecular formula C28H41Cl2NO5 and a molecular weight of 542.54 g/mol. Its IUPAC name is 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-ethoxyethyl]-2-(ethoxymethyl)phenol.
| Compound Name | 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-ethoxyethyl]-2-(ethoxymethyl)phenol |
|---|---|
| PubChem CID | 90076564 |
| Molecular Formula | C28H41Cl2NO5 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 4-[(1R)-2-[6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]hexylamino]-1-ethoxyethyl]-2-(ethoxymethyl)phenol |
| SMILES | CCOCc1cc([C@H](CNCCCCCCOCCOCc2c(Cl)cccc2Cl)OCC)ccc1O |
| InChI | InChI=1S/C28H41Cl2NO5/c1-3-33-20-23-18-22(12-13-27(23)32)28(36-4-2)19-31-14-7-5-6-8-15-34-16-17-35-21-24-25(29)10-9-11-26(24)30/h9-13,18,28,31-32H,3-8,14-17,19-21H2,1-2H3/t28-/m0/s1 |
| InChIKey | UNAMUGPBNBKELF-NDEPHWFRSA-N |
| XLogP | 6.70 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|