C30H43N3O5S — CID 22161748
N-[2-hydroxy-5-[1-hydroxy-2-[6-(6-quinolin-2-ylhexoxy)hexylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 22161748) has the molecular formula C30H43N3O5S and a molecular weight of 557.76 g/mol. Its IUPAC name is N-[2-hydroxy-5-[1-hydroxy-2-[6-(6-quinolin-2-ylhexoxy)hexylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[1-hydroxy-2-[6-(6-quinolin-2-ylhexoxy)hexylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22161748 |
| Molecular Formula | C30H43N3O5S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | N-[2-hydroxy-5-[1-hydroxy-2-[6-(6-quinolin-2-ylhexoxy)hexylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNCCCCCCOCCCCCCc2ccc3ccccc3n2)ccc1O |
| InChI | InChI=1S/C30H43N3O5S/c1-39(36,37)33-28-22-25(16-18-29(28)34)30(35)23-31-19-9-3-5-11-21-38-20-10-4-2-6-13-26-17-15-24-12-7-8-14-27(24)32-26/h7-8,12,14-18,22,30-31,33-35H,2-6,9-11,13,19-21,23H2,1H3 |
| InChIKey | RSRGHOZUKCDLCA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|