C26H32N2O6S — CID 72981161
N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(2-phenylmethoxyethoxy)phenyl]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 72981161) has the molecular formula C26H32N2O6S and a molecular weight of 500.62 g/mol. Its IUPAC name is N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(2-phenylmethoxyethoxy)phenyl]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(2-phenylmethoxyethoxy)phenyl]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 72981161 |
| Molecular Formula | C26H32N2O6S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(2-phenylmethoxyethoxy)phenyl]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNCCc2ccc(OCCOCc3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C26H32N2O6S/c1-35(31,32)28-24-17-22(9-12-25(24)29)26(30)18-27-14-13-20-7-10-23(11-8-20)34-16-15-33-19-21-5-3-2-4-6-21/h2-12,17,26-30H,13-16,18-19H2,1H3 |
| InChIKey | BVWGFLBWNSWVPH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|