C24H28N2O6S — CID 23134181
N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(3-methoxyphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 23134181) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(3-methoxyphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(3-methoxyphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 23134181 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(3-methoxyphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | COc1cccc(-c2ccc(OCCNCC(O)c3ccc(O)c(NS(C)(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-31-21-5-3-4-18(14-21)17-6-9-20(10-7-17)32-13-12-25-16-24(28)19-8-11-23(27)22(15-19)26-33(2,29)30/h3-11,14-15,24-28H,12-13,16H2,1-2H3 |
| InChIKey | DABJSBJYFMVZKA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|