C25H28N2O7S — CID 23134114
methyl 3-[4-[2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]benzoate (PubChem CID 23134114) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is methyl 3-[4-[2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]benzoate.
| Compound Name | methyl 3-[4-[2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 23134114 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl 3-[4-[2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(OCCNCC(O)c3ccc(O)c(NS(C)(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C25H28N2O7S/c1-33-25(30)20-5-3-4-18(14-20)17-6-9-21(10-7-17)34-13-12-26-16-24(29)19-8-11-23(28)22(15-19)27-35(2,31)32/h3-11,14-15,24,26-29H,12-13,16H2,1-2H3 |
| InChIKey | MVWVKNBFXRTNQD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|