C27H30N2O7S — CID 69200879
methyl 3-[3-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]phenyl]prop-2-enoate (PubChem CID 69200879) has the molecular formula C27H30N2O7S and a molecular weight of 526.61 g/mol. Its IUPAC name is methyl 3-[3-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[3-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69200879 |
| Molecular Formula | C27H30N2O7S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | methyl 3-[3-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]phenyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cccc(-c2ccc(OCCNC[C@H](O)c3ccc(O)c(NS(C)(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C27H30N2O7S/c1-35-27(32)13-6-19-4-3-5-21(16-19)20-7-10-23(11-8-20)36-15-14-28-18-26(31)22-9-12-25(30)24(17-22)29-37(2,33)34/h3-13,16-17,26,28-31H,14-15,18H2,1-2H3/t26-/m0/s1 |
| InChIKey | PGXANAIEGWNHTR-SANMLTNESA-N |
| XLogP | 3.32 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|