C26H30N2O7S — CID 69202175
4-[4-[2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,5-dimethylphenyl]benzoic acid (PubChem CID 69202175) has the molecular formula C26H30N2O7S and a molecular weight of 514.60 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,5-dimethylphenyl]benzoic acid.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,5-dimethylphenyl]benzoic acid |
|---|---|
| PubChem CID | 69202175 |
| Molecular Formula | C26H30N2O7S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,5-dimethylphenyl]benzoic acid |
| SMILES | Cc1cc(-c2ccc(C(=O)O)cc2)c(C)cc1OCCNC[C@@H](O)c1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H30N2O7S/c1-16-13-25(17(2)12-21(16)18-4-6-19(7-5-18)26(31)32)35-11-10-27-15-24(30)20-8-9-23(29)22(14-20)28-36(3,33)34/h4-9,12-14,24,27-30H,10-11,15H2,1-3H3,(H,31,32)/t24-/m1/s1 |
| InChIKey | MVMMIIBUGLHHBZ-XMMPIXPASA-N |
| XLogP | 3.45 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|