C24H28N2O7S2 — CID 23134227
N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 23134227) has the molecular formula C24H28N2O7S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 23134227 |
| Molecular Formula | C24H28N2O7S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNCCOc2ccc(-c3ccc(S(C)(=O)=O)cc3)cc2)ccc1O |
| InChI | InChI=1S/C24H28N2O7S2/c1-34(29,30)21-10-5-18(6-11-21)17-3-8-20(9-4-17)33-14-13-25-16-24(28)19-7-12-23(27)22(15-19)26-35(2,31)32/h3-12,15,24-28H,13-14,16H2,1-2H3 |
| InChIKey | CQQAODOWCMFCMJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|