C25H28N2O7S — CID 69203455
4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2-methylphenyl]benzoic acid (PubChem CID 69203455) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2-methylphenyl]benzoic acid.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 69203455 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2-methylphenyl]benzoic acid |
| SMILES | Cc1cc(OCCNC[C@H](O)c2ccc(O)c(NS(C)(=O)=O)c2)ccc1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H28N2O7S/c1-16-13-20(8-9-21(16)17-3-5-18(6-4-17)25(30)31)34-12-11-26-15-24(29)19-7-10-23(28)22(14-19)27-35(2,32)33/h3-10,13-14,24,26-29H,11-12,15H2,1-2H3,(H,30,31)/t24-/m0/s1 |
| InChIKey | BMNPYRSWUXHSEF-DEOSSOPVSA-N |
| XLogP | 3.14 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|