C23H29ClN2O5S2 — CID 22111247
N-[2-hydroxy-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydrodibenzothiophen-3-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride (PubChem CID 22111247) has the molecular formula C23H29ClN2O5S2 and a molecular weight of 513.08 g/mol. Its IUPAC name is N-[2-hydroxy-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydrodibenzothiophen-3-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydrodibenzothiophen-3-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22111247 |
| Molecular Formula | C23H29ClN2O5S2 |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | N-[2-hydroxy-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydrodibenzothiophen-3-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNCCOc2ccc3c4c(sc3c2)CCCC4)ccc1O.Cl |
| InChI | InChI=1S/C23H28N2O5S2.ClH/c1-32(28,29)25-19-12-15(6-9-20(19)26)21(27)14-24-10-11-30-16-7-8-18-17-4-2-3-5-22(17)31-23(18)13-16;/h6-9,12-13,21,24-27H,2-5,10-11,14H2,1H3;1H |
| InChIKey | INJKAZMJPHULGW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|