C21H26N2O4S2 — CID 12044239
N-[3-[(1R)-2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 12044239) has the molecular formula C21H26N2O4S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[3-[(1R)-2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(1R)-2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 12044239 |
| Molecular Formula | C21H26N2O4S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[3-[(1R)-2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | Cc1sc2cc(OCCNC[C@H](O)c3cccc(NS(C)(=O)=O)c3)ccc2c1C |
| InChI | InChI=1S/C21H26N2O4S2/c1-14-15(2)28-21-12-18(7-8-19(14)21)27-10-9-22-13-20(24)16-5-4-6-17(11-16)23-29(3,25)26/h4-8,11-12,20,22-24H,9-10,13H2,1-3H3/t20-/m0/s1 |
| InChIKey | FXYLIYQQSSBOSQ-FQEVSTJZSA-N |
| XLogP | 3.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|