C27H40N2O4S2Si — CID 22141423
N-[3-[2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide (PubChem CID 22141423) has the molecular formula C27H40N2O4S2Si and a molecular weight of 548.85 g/mol. Its IUPAC name is N-[3-[2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22141423 |
| Molecular Formula | C27H40N2O4S2Si |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[3-[2-[2-[(2,3-dimethyl-1-benzothiophen-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide |
| SMILES | CC[Si](CC)(CC)OC(CNCCOc1ccc2c(C)c(C)sc2c1)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C27H40N2O4S2Si/c1-7-36(8-2,9-3)33-26(22-11-10-12-23(17-22)29-35(6,30)31)19-28-15-16-32-24-13-14-25-20(4)21(5)34-27(25)18-24/h10-14,17-18,26,28-29H,7-9,15-16,19H2,1-6H3 |
| InChIKey | PAOYLSRORIKOMV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|