C24H31N3O6S — CID 85337324
ethyl 2-[6-[2-[[2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl]acetate (PubChem CID 85337324) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is ethyl 2-[6-[2-[[2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl]acetate.
| Compound Name | ethyl 2-[6-[2-[[2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl]acetate |
|---|---|
| PubChem CID | 85337324 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | ethyl 2-[6-[2-[[2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1[nH]c2cc(OCCNCC(O)c3cccc(NS(C)(=O)=O)c3)ccc2c1C |
| InChI | InChI=1S/C24H31N3O6S/c1-4-32-24(29)14-21-16(2)20-9-8-19(13-22(20)26-21)33-11-10-25-15-23(28)17-6-5-7-18(12-17)27-34(3,30)31/h5-9,12-13,23,25-28H,4,10-11,14-15H2,1-3H3 |
| InChIKey | GAHVIWRMNSMYKE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|