C23H29N3O7S — CID 66911906
ethyl [5-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl] carbonate (PubChem CID 66911906) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is ethyl [5-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl] carbonate.
| Compound Name | ethyl [5-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl] carbonate |
|---|---|
| PubChem CID | 66911906 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | ethyl [5-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-3-methyl-1H-indol-2-yl] carbonate |
| SMILES | CCOC(=O)Oc1[nH]c2ccc(OCCNC[C@H](O)c3cccc(NS(C)(=O)=O)c3)cc2c1C |
| InChI | InChI=1S/C23H29N3O7S/c1-4-31-23(28)33-22-15(2)19-13-18(8-9-20(19)25-22)32-11-10-24-14-21(27)16-6-5-7-17(12-16)26-34(3,29)30/h5-9,12-13,21,24-27H,4,10-11,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | VCXPCBRLEYAEMP-NRFANRHFSA-N |
| XLogP | 3.09 |
| TPSA | 138.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|