C23H24N2O5S — CID 15887685
N-[3-[2-(2-dibenzofuran-3-yloxyethylamino)-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 15887685) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[3-[2-(2-dibenzofuran-3-yloxyethylamino)-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-(2-dibenzofuran-3-yloxyethylamino)-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 15887685 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[3-[2-(2-dibenzofuran-3-yloxyethylamino)-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(O)CNCCOc2ccc3c(c2)oc2ccccc23)c1 |
| InChI | InChI=1S/C23H24N2O5S/c1-31(27,28)25-17-6-4-5-16(13-17)21(26)15-24-11-12-29-18-9-10-20-19-7-2-3-8-22(19)30-23(20)14-18/h2-10,13-14,21,24-26H,11-12,15H2,1H3 |
| InChIKey | JOZSWZXNFNAMQE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|