C28H34N2O7S — CID 172685651
2-[4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,6-dimethylphenyl]phenyl]propanoic acid (PubChem CID 172685651) has the molecular formula C28H34N2O7S and a molecular weight of 542.65 g/mol. Its IUPAC name is 2-[4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,6-dimethylphenyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,6-dimethylphenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 172685651 |
| Molecular Formula | C28H34N2O7S |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2-[4-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]ethoxy]-2,6-dimethylphenyl]phenyl]propanoic acid |
| SMILES | Cc1cc(OCCNC[C@H](O)c2ccc(O)c(NS(C)(=O)=O)c2)cc(C)c1-c1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C28H34N2O7S/c1-17-13-23(14-18(2)27(17)21-7-5-20(6-8-21)19(3)28(33)34)37-12-11-29-16-26(32)22-9-10-25(31)24(15-22)30-38(4,35)36/h5-10,13-15,19,26,29-32H,11-12,16H2,1-4H3,(H,33,34)/t19?,26-/m0/s1 |
| InChIKey | AZQONNMBXJYYTH-SYCQMTRVSA-N |
| XLogP | 3.94 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|