C29H45N3O6S — CID 140555435
N-[5-[(1S)-2-[6-[4-(2-tert-butyl-3-sulfamoylphenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 140555435) has the molecular formula C29H45N3O6S and a molecular weight of 563.76 g/mol. Its IUPAC name is N-[5-[(1S)-2-[6-[4-(2-tert-butyl-3-sulfamoylphenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1S)-2-[6-[4-(2-tert-butyl-3-sulfamoylphenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 140555435 |
| Molecular Formula | C29H45N3O6S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | N-[5-[(1S)-2-[6-[4-(2-tert-butyl-3-sulfamoylphenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | CC(C)(C)c1c(CCCCOCCCCCCNC[C@@H](O)c2ccc(O)c(NC=O)c2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C29H45N3O6S/c1-29(2,3)28-22(12-10-13-27(28)39(30,36)37)11-6-9-18-38-17-8-5-4-7-16-31-20-26(35)23-14-15-25(34)24(19-23)32-21-33/h10,12-15,19,21,26,31,34-35H,4-9,11,16-18,20H2,1-3H3,(H,32,33)(H2,30,36,37)/t26-/m1/s1 |
| InChIKey | VYBCYYKVSKCIIQ-AREMUKBSSA-N |
| XLogP | 4.13 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|