C30H35NO7 — CID 91303829
[2-(2-hydroxyethyl)-4-[1-hydroxy-2-[2-[2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethylamino]ethyl]phenyl] acetate (PubChem CID 91303829) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)-4-[1-hydroxy-2-[2-[2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethylamino]ethyl]phenyl] acetate.
| Compound Name | [2-(2-hydroxyethyl)-4-[1-hydroxy-2-[2-[2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethylamino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 91303829 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | [2-(2-hydroxyethyl)-4-[1-hydroxy-2-[2-[2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethylamino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(O)CNCCc2ccc3c(c2)OCC(COCc2ccccc2)O3)cc1CCO |
| InChI | InChI=1S/C30H35NO7/c1-21(33)37-28-10-8-24(16-25(28)12-14-32)27(34)17-31-13-11-22-7-9-29-30(15-22)36-20-26(38-29)19-35-18-23-5-3-2-4-6-23/h2-10,15-16,26-27,31-32,34H,11-14,17-20H2,1H3 |
| InChIKey | NFIOBHNKXMPQGE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|