C30H37NO5 — CID 69438540
(1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[2-[4-(2-phenylmethoxyethoxymethyl)phenyl]ethylamino]ethanol (PubChem CID 69438540) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[2-[4-(2-phenylmethoxyethoxymethyl)phenyl]ethylamino]ethanol.
| Compound Name | (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[2-[4-(2-phenylmethoxyethoxymethyl)phenyl]ethylamino]ethanol |
|---|---|
| PubChem CID | 69438540 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[2-[4-(2-phenylmethoxyethoxymethyl)phenyl]ethylamino]ethanol |
| SMILES | CC1(C)OCc2cc([C@@H](O)CNCCc3ccc(COCCOCc4ccccc4)cc3)ccc2O1 |
| InChI | InChI=1S/C30H37NO5/c1-30(2)35-22-27-18-26(12-13-29(27)36-30)28(32)19-31-15-14-23-8-10-25(11-9-23)21-34-17-16-33-20-24-6-4-3-5-7-24/h3-13,18,28,31-32H,14-17,19-22H2,1-2H3/t28-/m0/s1 |
| InChIKey | GNXPUMCMHUDJHD-NDEPHWFRSA-N |
| XLogP | 4.93 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|