C31H36N2O4 — CID 69385407
3-[4-[4-[2-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]ethyl]phenoxy]butyl]benzonitrile (PubChem CID 69385407) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 3-[4-[4-[2-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]ethyl]phenoxy]butyl]benzonitrile.
| Compound Name | 3-[4-[4-[2-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]ethyl]phenoxy]butyl]benzonitrile |
|---|---|
| PubChem CID | 69385407 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 3-[4-[4-[2-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]ethyl]phenoxy]butyl]benzonitrile |
| SMILES | CC1(C)OCc2cc([C@@H](O)CNCCc3ccc(OCCCCc4cccc(C#N)c4)cc3)ccc2O1 |
| InChI | InChI=1S/C31H36N2O4/c1-31(2)36-22-27-19-26(11-14-30(27)37-31)29(34)21-33-16-15-23-9-12-28(13-10-23)35-17-4-3-6-24-7-5-8-25(18-24)20-32/h5,7-14,18-19,29,33-34H,3-4,6,15-17,21-22H2,1-2H3/t29-/m0/s1 |
| InChIKey | PLJIKJBYIKYRJQ-LJAQVGFWSA-N |
| XLogP | 5.47 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|